![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
.jpg){kind=link}
_1.jpg){kind=link}
.jpg){kind=link}
_1.jpg){kind=link}
.jpg){kind=link}
![[ ]](/icons/p.gif){kind=icon}
.png){kind=link}
%20FIAlyzer%201000.jpg){kind=link}
![[ ]](/icons/compressed.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| xaivhost/ | 2025-05-02 06:50 | - | |
| x.c | 2025-04-29 22:06 | 9.6K | |
| x | 2025-04-29 22:12 | 764K | |
| wp_top10_errors_part..> | 2023-05-29 09:16 | 1.0M | |
| white-bg.jpg | 2017-04-18 15:31 | 2.1K | |
| water chiller.jpg | 2022-11-07 16:09 | 41K | |
| vhost.php | 2025-02-16 11:27 | 1.3K | |
| ultrawave3.jpg | 2023-05-16 09:48 | 90K | |
| ultraWAVE-brochure-s..> | 2020-12-15 16:17 | 5.6M | |
| ultraWAVE-brochure-s..> | 2020-12-15 16:17 | 5.6M | |
| ultraWAVE-3 Diagram.png | 2023-05-18 09:40 | 174K | |
| ultraWAVE-3-Brochure..> | 2023-05-18 09:38 | 7.5M | |
| trans retsch milling..> | 2025-04-02 09:55 | 64K | |
| traceCLEAN_Infograph..> | 2021-02-02 15:27 | 5.6M | |
| to10_small.png | 2019-01-25 11:22 | 63K | |
| suppliers/ | 2023-03-31 10:51 | - | |
| spex-sampleprep-logo..> | 2022-09-12 10:13 | 3.6K | |
| spex-sampleprep-logo..> | 2022-05-04 11:05 | 3.6K | |
| spex-sampleprep-logo..> | 2022-05-04 09:59 | 3.6K | |
| spec_milestone_12122..> | 2023-11-28 09:49 | 115K | |
| spec_milestone_12122..> | 2023-11-28 09:50 | 120K | |
| spec_milestone_12122..> | 2023-11-28 09:50 | 82K | |
| spec_milestone_12122..> | 2023-11-28 09:49 | 82K | |
| spec_milestone_12122..> | 2023-11-28 09:48 | 31K | |
| spec_milestone_07142..> | 2022-07-12 10:18 | 139K | |
| soil-spring.jpg | 2025-04-16 13:10 | 38K | |
| shelf life and susta..> | 2025-02-26 08:46 | 49K | |
| sdx-hpld.png | 2023-06-12 08:34 | 38K | |
| sampleprep-2.jpg | 2025-05-23 11:52 | 1.4M | |
| retsch-gmbh-logo-vec..> | 2021-06-15 10:00 | 4.3K | |
| pw/ | 2025-02-17 02:00 | - | |
| pt80.png | 2022-11-07 14:55 | 299K | |
| products/ | 2021-10-12 15:43 | - | |
| pic_camsizer-x2_x-je..> | 2025-03-14 10:24 | 1.4M | |
| pic_camsizer-x2_x-fa..> | 2025-03-14 10:34 | 5.7M | |
| pic_camsizer-x2_funk..> | 2025-03-14 10:25 | 6.5M | |
| pic-turbiscan-lab-le..> | 2024-04-18 11:33 | 69K | |
| pic-hm200-closed-fro..> | 2022-07-04 11:22 | 89K | |
| pic-belsorp-max-x-x-..> | 2023-01-31 13:42 | 107K | |
| pic-belsorp-max-x-ri..> | 2023-01-31 13:18 | 41K | |
| pharma.jpg | 2025-05-14 16:42 | 36K | |
| pd.php | 2025-02-16 11:32 | 19K | |
| particle size analys..> | 2025-05-23 11:41 | 56K | |
| oxidation-stability-..> | 2025-03-12 15:45 | 486K | |
| oxidation-stability-..> | 2025-03-12 15:46 | 512K | |
| organic sample prep.jpg | 2025-05-23 12:45 | 58K | |
| no_argon_scientist_h..> | 2023-07-25 15:08 | 1.0M | |
| news/ | 2023-03-31 13:56 | - | |
| microtrac mrb logo.png | 2021-12-02 16:13 | 4.5K | |
| microplastic-header ..> | 2022-06-27 11:21 | 80K | |
| micromeritics.png | 2022-05-04 10:23 | 59K | |
| microfluidics_cover.jpg | 2024-03-18 16:55 | 35K | |
| manual_hm200_21.753...> | 2022-07-04 11:29 | 4.9M | |
| manual_dustmon_rd100..> | 2023-02-21 11:15 | 2.2M | |
| lovibond-tintometer-..> | 2022-06-07 10:03 | 34K | |
| logo_microtrac_4c_1.png | 2025-01-22 08:57 | 20K | |
| logo_microtrac_4c.png | 2025-01-17 10:48 | 20K | |
| logo-axxicon-2000px.png | 2024-01-09 11:34 | 29K | |
| linkedin tomorrow.webp | 2025-02-26 08:43 | 86K | |
| lab fume hoods.jpg | 2024-01-12 11:42 | 470K | |
| lab countertops.jpg | 2024-01-12 11:38 | 91K | |
| lab casework.jpg | 2024-01-12 11:34 | 479K | |
| jobs/ | 2025-04-24 10:59 | - | |
| inews-erweka01.jpg | 2024-11-21 13:18 | 55K | |
| images/ | 2023-12-06 09:18 | - | |
| id.txt | 2025-02-16 11:25 | 0 | |
| iStock-1962473050.jpg | 2025-04-09 08:44 | 3.2M | |
| header-workflow-effi..> | 2023-03-02 10:05 | 71K | |
| header-workflow-effi..> | 2023-03-02 10:02 | 71K | |
| header-extraction-en..> | 2022-01-20 14:11 | 55K | |
| header-extraction-en..> | 2022-01-20 13:42 | 55K | |
| hc-80000.png | 2022-07-28 09:29 | 151K | |
| food banner blog.png | 2025-05-23 12:55 | 5.6M | |
| file.txt | 2020-12-15 16:30 | 0 | |
| etch_FIAlyzer-FLEX f..> | 2020-08-18 14:53 | 431K | |
| estimated-shelf-life..> | 2025-03-12 15:46 | 387K | |
| environment soil 2.jpg | 2025-04-16 13:19 | 224K | |
| elementrac.jpg | 2024-06-19 08:43 | 108K | |
| easycheck banner.png | 2024-06-13 09:26 | 1.2M | |
| easyFILL.jpg | 2023-02-06 10:25 | 111K | |
| dt-light.png | 2023-12-01 09:04 | 666K | |
| drt-00.jpg | 2023-12-04 11:31 | 219K | |
| download mfic m110P.jpg | 2020-07-27 10:07 | 9.3K | |
| dma-80-low-running-c..> | 2025-04-01 11:10 | 69K | |
| dir.php | 2025-02-16 11:19 | 18K | |
| csi.jpg | 2025-03-05 08:55 | 108K | |
| cosmetics-iso-webina..> | 2022-04-20 09:34 | 72K | |
| coming soon - web.jpg | 2023-06-30 11:37 | 40K | |
| coming-soon-business..> | 2023-06-30 11:35 | 152K | |
| cg900-cryo-blade.png | 2025-01-09 11:23 | 136K | |
| cannabis.jpg | 2022-11-07 16:32 | 5.9K | |
| camsizer-3d-person2.png | 2023-02-13 15:25 | 940K | |
| bypass_disablefunc_x..> | 2025-04-29 22:12 | 6.8K | |
| bta_brochure.pdf | 2022-05-04 10:53 | 9.9M | |
| brochure_turbiscan_e..> | 2025-03-28 09:49 | 5.0M | |
| brochure_overview_en..> | 2023-07-18 14:13 | 3.2M | |
| brochure_mrb_sync_en..> | 2023-05-29 09:21 | 3.5M | |
| brochure_mrb_overvie..> | 2022-08-16 12:52 | 7.1M | |
| brochure_mrb_camsize..> | 2025-03-14 10:33 | 1.7M | |
| brochure_mrb_camsize..> | 2025-03-14 10:28 | 1.7M | |
| belpore_Page_4.png | 2025-01-28 11:27 | 88K | |
| belpore_Page_3.png | 2025-01-28 11:27 | 1.4M | |
| belpore_Page_2.png | 2025-01-28 11:26 | 194K | |
| belpore_Page_1.png | 2025-01-28 11:26 | 620K | |
| bdf.php | 2025-02-17 01:59 | 14K | |
| battery webinar - mi..> | 2023-09-14 08:53 | 57K | |
| back.pl | 2025-02-17 01:58 | 708 | |
| axxicon-aim-mould-sy..> | 2024-01-09 11:30 | 30K | |
| ats-logo-reverse-rgb..> | 2020-08-18 15:27 | 28K | |
| ats-logo-reverse-rgb..> | 2020-02-13 15:30 | 297K | |
| ats-logo-reverse-rgb..> | 2020-02-13 15:30 | 297K | |
| aso.txt | 2025-02-16 11:25 | 0 | |
| aralab logo.png | 2022-10-03 10:26 | 4.7K | |
| aralab banner no log..> | 2024-06-04 11:38 | 674K | |
| aralab banner.jpg | 2024-03-18 16:46 | 75K | |
| aq700_1.png | 2025-01-29 09:42 | 523K | |
| aq700.png | 2023-06-30 12:27 | 523K | |
| andf-determination-i..> | 2022-10-05 09:53 | 637K | |
| adminer-4.8.1.php | 2025-05-20 19:33 | 465K | |
| ZT_Series 320.pdf | 2023-12-04 11:45 | 1.5M | |
| ZT_Serie_2023_EN_Web..> | 2023-12-04 11:39 | 1.5M | |
| ZT_322.png | 2023-12-04 11:44 | 312K | |
| ZT730_EN_Web.pdf | 2023-12-04 13:05 | 1.2M | |
| ZT 320.png | 2023-12-04 11:43 | 864K | |
| ZT 120.png | 2023-12-04 11:36 | 765K | |
| ZT-730_Normalperspek..> | 2023-12-04 13:03 | 3.8M | |
| ZT-121-light_Ansicht..> | 2023-12-04 11:36 | 71K | |
| Your Central Canada ..> | 2020-03-19 14:08 | 2.3M | |
| Your Central Canada ..> | 2020-03-19 14:07 | 2.3M | |
| Xenemetrix X ROHS SD..> | 2017-07-04 16:27 | 301K | |
| Xenemetrix X ROHS SD..> | 2017-07-04 16:20 | 301K | |
| Xenemetrix X ROHS SD..> | 2017-07-04 16:18 | 301K | |
| Xenemetrix X ROHS SD..> | 2017-07-04 16:15 | 301K | |
| Xenemetrix X ROHS SD..> | 2017-07-04 16:13 | 301K | |
| Xenemetrix X-Calibur..> | 2017-07-04 16:47 | 277K | |
| Xenemetrix X-Calibur..> | 2017-07-04 16:39 | 277K | |
| Xenemetrix P metrix...> | 2017-07-04 11:21 | 28K | |
| Xenemetrix Genius IF..> | 2017-07-04 16:33 | 230K | |
| XP-400_3_Lg.png | 2025-01-24 11:24 | 583K | |
| XELSIUS REACTION SOL..> | 2022-11-07 16:19 | 100K | |
| Whitehouse Scientifi..> | 2021-12-03 13:02 | 61K | |
| White Paper- Extract..> | 2025-01-27 14:27 | 458K | |
| White Paper- Extract..> | 2025-01-27 14:24 | 458K | |
| White Paper- Extract..> | 2025-01-27 14:26 | 415K | |
| White Paper- Extract..> | 2025-01-27 14:24 | 415K | |
| White Paper- Extract..> | 2025-01-27 14:26 | 621K | |
| White Paper- Extract..> | 2025-01-27 14:24 | 621K | |
| White Paper- Extract..> | 2025-01-27 14:25 | 262K | |
| White Paper- Extract..> | 2025-01-27 14:24 | 262K | |
| White Paper- Extract..> | 2025-01-27 14:24 | 2.0M | |
| White Paper- Extract..> | 2025-01-27 14:22 | 1.5M | |
| Western Canada - Wor..> | 2023-09-26 16:24 | 688K | |
| Waterloo MICAP Invit..> | 2023-10-03 15:45 | 821K | |
| Waterloo MICAP Invit..> | 2023-09-26 16:21 | 820K | |
| Water Chiller Techni..> | 2022-11-07 16:14 | 577K | |
| Water Chiller H50-50..> | 2022-11-07 16:13 | 1.3M | |
| Water Chiller H50-24..> | 2022-11-07 16:13 | 661K | |
| Water Chiller.pdf | 2022-11-07 16:12 | 4.7M | |
| Versa.jpg | 2017-10-23 12:14 | 96K | |
| Velp vettoriale - Of..> | 2024-04-30 13:02 | 291K | |
| VELP Scientifica OXI..> | 2017-04-18 14:58 | 455K | |
| VELP Scientifica OXI..> | 2017-04-18 14:58 | 455K | |
| VELP Scientifica Log..> | 2022-08-30 13:48 | 6.1K | |
| VELPSER-158rev05-2-2..> | 2024-12-06 08:45 | 2.7M | |
| VELP PRODUCTS PORTFO..> | 2022-10-05 09:51 | 1.6M | |
| VELP EMA 502 Brochur..> | 2025-04-11 12:03 | 1.8M | |
| VELP.png | 2023-11-14 10:33 | 844K | |
| University of Calgar..> | 2020-02-25 16:10 | 173K | |
| UW_AppNote_ConsumerP..> | 2020-12-15 16:57 | 2.8M | |
| UDK169-04-251842-251..> | 2022-08-30 14:29 | 192K | |
| Turbiscan for Metals..> | 2025-03-28 09:46 | 925K | |
| Turbiscan for Coatin..> | 2025-03-27 09:10 | 263K | |
| Turbiscan_Lab_Banner..> | 2024-04-18 11:40 | 78K | |
| Torch_sm.png | 2025-01-14 15:07 | 93K | |
| Torch.jpg | 2017-10-23 12:13 | 163K | |
| Top 10 Errors in Par..> | 2022-08-26 11:11 | 1.0M | |
| Title Banner.png | 2023-05-31 15:05 | 105K | |
| Thomas Scientific.png | 2022-11-07 10:23 | 2.5K | |
| The Kjeldahl Method.pdf | 2022-08-30 14:10 | 464K | |
| The Expert Art of Mi..> | 2023-03-24 09:19 | 1.8M | |
| Terpene Extraction.jpg | 2022-11-04 10:17 | 542K | |
| Teledyne Labs Logo_2..> | 2024-01-19 09:27 | 61K | |
| Teledyne Labs Logo_1..> | 2024-01-19 09:24 | 179K | |
| Teledyne Labs Logo.png | 2024-01-19 09:22 | 5.0K | |
| Teledyne Labs Banner..> | 2024-01-19 09:36 | 1.7M | |
| Technology_Report_Pr..> | 2020-12-15 16:19 | 1.6M | |
| Technology-Report-Te..> | 2022-08-02 16:11 | 3.1M | |
| Technical Specificat..> | 2023-02-17 19:36 | 188K | |
| Technical Sales Repr..> | 2025-04-24 09:02 | 286K | |
| TM500.jpg | 2022-04-19 12:07 | 210K | |
| TELEDYNE PROMO.png | 2021-11-04 10:43 | 855K | |
| Staff photos/ | 2022-06-09 13:07 | - | |
| Stabino Zeta and CBD..> | 2022-08-26 11:04 | 516K | |
| Stabino Zeta - Contr..> | 2022-08-26 11:05 | 434K | |
| Stabino Zeta & Nanot..> | 2022-08-26 11:06 | 435K | |
| Stabino Zeta & Carbo..> | 2022-08-26 11:07 | 357K | |
| Spex Sample Prep 677..> | 2017-04-18 14:58 | 395K | |
| Spex SamplePrep 3636..> | 2017-04-18 14:58 | 1.4M | |
| Spex Sample Prep - W..> | 2022-05-04 09:53 | 5.0K | |
| Spec_Milestone_12092..> | 2021-12-03 08:56 | 28K | |
| Spec_Milestone_11162..> | 2023-10-26 09:31 | 132K | |
| Spec_Milestone_11162..> | 2023-10-26 09:31 | 97K | |
| Spec_Milestone_11162..> | 2023-10-26 09:31 | 152K | |
| Spec_Milestone_11162..> | 2023-10-26 09:31 | 1.2M | |
| Spec_MIlestone_05222..> | 2024-05-15 13:22 | 59K | |
| Spec_MIlestone_05222..> | 2024-05-15 13:22 | 70K | |
| Simplest-Responsive-..> | 2017-10-23 10:47 | 27K | |
| Simplest-Responsive-..> | 2017-10-23 10:43 | 27K | |
| Seal Analytical Logo..> | 2023-06-30 12:17 | 48K | |
| Seal Analytical Logo..> | 2023-06-30 11:29 | 51K | |
| Schmelzpunktmessgera..> | 2022-11-07 11:58 | 543K | |
| Schmelzpunktmessgera..> | 2022-11-07 11:58 | 543K | |
| Schmelzpunktmessgera..> | 2022-11-07 11:50 | 500K | |
| SV10_View1_LowR.png | 2020-07-21 11:26 | 165K | |
| SP20_View1_LowR .png | 2020-07-21 11:26 | 71K | |
| SP20_Leaflet_En[A] r..> | 2020-07-22 09:10 | 389K | |
| SP10-Leaflet-EnC Jun..> | 2020-06-08 10:37 | 466K | |
| SM-200_2_Lg.png | 2025-01-24 11:25 | 359K | |
| SK 300 Manual.pdf | 2022-05-03 10:40 | 3.0M | |
| SER 158.jpg | 2022-08-30 14:58 | 55K | |
| SEAL_AQ400_Discrete_..> | 2025-04-01 16:03 | 35K | |
| SEAL_AQ400_Discrete_..> | 2023-06-30 12:23 | 35K | |
| Rotors_new.pdf | 2021-02-02 15:17 | 2.0M | |
| Rotary Evaporator.pdf | 2022-11-07 16:05 | 404K | |
| Richardson Workshop ..> | 2025-03-24 13:55 | 1.3M | |
| Retsch Technology br..> | 2017-04-18 14:58 | 3.6M | |
| Retsch SM 50 Product..> | 2025-04-02 10:05 | 435K | |
| Retsch SK 300.png | 2022-05-03 10:25 | 219K | |
| Retsch Mixer Mill MM..> | 2023-05-01 10:36 | 137K | |
| Retsch Camsizer X2.png | 2017-04-18 14:58 | 418K | |
| Retsch Camsizer P4 i..> | 2017-04-18 14:58 | 194K | |
| Register.png | 2022-05-26 10:34 | 4.4K | |
| Radom MICAPOES 1000 ..> | 2023-07-25 15:26 | 411K | |
| ROI_duopur_subclean_..> | 2021-02-02 15:17 | 108K | |
| RETSCH logo 2022.png | 2022-05-04 10:14 | 7.4K | |
| RETSCH logo 2022.jpg..> | 2022-05-04 10:17 | 14K | |
| RETSCH SM 50 GLAMOUR..> | 2025-04-02 09:52 | 92K | |
| RADOM MICAPOES_PRODU..> | 2023-07-25 15:28 | 2.1M | |
| RADOM MICAPOES_PRODU..> | 2023-07-25 15:25 | 2.1M | |
| RADOM LOGO_2.png | 2023-07-25 14:26 | 26K | |
| RADOM LOGO_1.png | 2023-07-25 14:17 | 26K | |
| RADOM LOGO.png | 2023-07-25 14:13 | 29K | |
| QUAATRO39.jpg | 2023-06-30 12:42 | 667K | |
| QAS International Ce..> | 2022-06-02 12:52 | 3.6M | |
| Products for the Pha..> | 2024-07-05 11:37 | 386K | |
| Products for the Pha..> | 2024-07-05 11:36 | 386K | |
| Products for the Pha..> | 2024-07-05 11:36 | 420K | |
| Products for the Foo..> | 2024-12-05 08:20 | 175K | |
| Products for Petrole..> | 2024-12-18 12:45 | 771K | |
| Products for Petrole..> | 2024-12-18 12:43 | 771K | |
| Products for Petrole..> | 2024-12-18 12:43 | 1.1M | |
| Products for Petrole..> | 2024-12-18 12:41 | 2.7M | |
| Products for Particl..> | 2024-12-04 13:38 | 163K | |
| Product Performance ..> | 2025-03-24 13:57 | 856K | |
| Product Performance ..> | 2025-02-26 15:06 | 820K | |
| Popover-DFZll.jpg | 2023-12-04 10:38 | 106K | |
| Polarimeter-P8000-TF..> | 2022-11-07 13:47 | 870K | |
| Polarimeter-P8000-TF..> | 2022-11-07 13:32 | 870K | |
| Particle Size Banner..> | 2025-05-23 13:03 | 3.2M | |
| Particle Size Analys..> | 2025-05-23 11:36 | 324K | |
| PYRO Microwave Ashin..> | 2022-12-30 08:46 | 111K | |
| PYRO Brochure.pdf | 2022-12-30 08:58 | 732K | |
| PT 200.jpg | 2025-04-04 14:33 | 14K | |
| PT-200.jpg | 2022-09-01 10:28 | 4.7K | |
| PSA_Guidebook.pdf | 2017-04-18 14:58 | 2.7M | |
| PRODUCTS FOR FOOD AN..> | 2023-03-10 10:27 | 4.2M | |
| PRODUCTS FOR FOOD AN..> | 2023-03-17 10:14 | 3.9M | |
| PM 400.pdf | 2023-07-07 08:35 | 419K | |
| PM 300 Interior.jpg | 2023-07-18 14:12 | 94K | |
| PM 300.jpg | 2023-07-18 14:06 | 63K | |
| PAC - PRODUCTS FOR P..> | 2024-12-04 13:13 | 207K | |
| Oxidation Studies no..> | 2017-04-18 14:58 | 332K | |
| OXITEST GLAMOUR 2_1.png | 2025-03-18 13:06 | 1.7M | |
| OXITEST GLAMOUR 2.png | 2025-03-12 15:33 | 1.7M | |
| OXITEST.jpg | 2022-08-31 10:25 | 30K | |
| ORGANIC SCALE-UP.png | 2025-05-23 12:53 | 5.0M | |
| ORAC_BERTRAND.avif | 2025-05-23 11:57 | 49K | |
| OCannaBIZ Header.png..> | 2022-05-26 10:25 | 46K | |
| OCannaBIZ Header.png | 2022-05-26 10:25 | 37K | |
| Nick Borcic.jpg | 2022-06-21 10:46 | 96K | |
| NAB Webinar 4-new ph..> | 2023-01-26 12:46 | 911K | |
| MultiVap 54.jpg | 2022-11-07 15:25 | 36K | |
| MultiVap54 – Produ..> | 2022-11-07 15:36 | 239K | |
| Mixer Mill MM 400.pdf | 2024-07-05 12:33 | 1.1M | |
| MiniLab BOD Analyzer..> | 2023-07-05 14:54 | 310K | |
| Milestone_PCB_AppNot..> | 2025-01-03 15:24 | 118K | |
| Milestone UltraWAVE ..> | 2017-04-18 14:58 | 332K | |
| Milestone UltraWAVE ..> | 2017-04-18 14:58 | 332K | |
| Milestone UltraWAVE ..> | 2017-04-18 14:58 | 332K | |
| Milestone Live Webca..> | 2022-06-02 09:35 | 640K | |
| Milestone 2020/ | 2020-12-15 16:29 | - | |
| Milestone/ | 2022-04-27 10:20 | - | |
| MicrotracMRB 2023.png | 2023-01-03 14:23 | 484K | |
| Microtrac -01.png | 2022-03-04 08:16 | 6.3K | |
| Microfluidics produc..> | 2017-04-18 14:58 | 1.4M | |
| Microfluidics Newsle..> | 2025-03-25 08:59 | 877K | |
| Microfluidics Logo 2..> | 2022-05-04 10:11 | 20K | |
| Microfluidics Logo 2..> | 2022-05-04 10:09 | 17K | |
| Metals in Cannabis.jpg | 2021-06-11 10:02 | 326K | |
| MediPrep_820_1.png | 2023-12-04 10:59 | 111K | |
| MediPrep Table.png | 2023-12-04 12:49 | 419K | |
| MediPrepSeries_EN_01..> | 2023-12-04 10:58 | 1.1M | |
| MediPrep.png | 2023-12-04 10:55 | 698K | |
| Manta ViewSizerT 300..> | 2017-04-18 14:58 | 279K | |
| Manta Instruments Vi..> | 2017-04-18 14:58 | 125K | |
| Manta Instruments Na..> | 2017-04-18 14:58 | 108K | |
| Manta Instruments Lo..> | 2017-04-18 14:58 | 13K | |
| Main.Nurture_Header_..> | 2020-12-16 15:47 | 73K | |
| Main.NurtureHeader-d..> | 2021-02-02 14:51 | 122K | |
| Main.Nurture-Header-..> | 2021-02-02 14:51 | 130K | |
| Main.Nurture-Header-..> | 2021-02-02 14:51 | 107K | |
| Main.Nurture-Header-..> | 2021-01-07 16:02 | 73K | |
| MRB.png | 2023-01-03 14:26 | 584K | |
| MP350-Microlyser-1.jpg | 2024-02-13 10:06 | 50K | |
| MICROTRAC Particle A..> | 2025-03-14 10:32 | - | |
| MICROLYSER-MP350-Bro..> | 2024-02-13 10:18 | 4.1M | |
| MICAP Invitation - A..> | 2023-09-06 10:52 | 928K | |
| MICAP Invitation - A..> | 2023-09-06 10:51 | 4.9M | |
| MICAP-OES 1000.png | 2023-07-25 14:28 | 136K | |
| MICAP-OES 1000 - 1.png | 2023-07-25 14:19 | 381K | |
| MICAP™-OES 1000 Cu..> | 2023-08-09 11:14 | 1.1M | |
| MF-M110P-Pharma Basi..> | 2020-07-27 10:17 | 1.1M | |
| MF-APPLICATION-NOTE-..> | 2025-03-25 09:08 | 1.6M | |
| MF-APPLICATION-NOTE-..> | 2025-03-10 13:03 | 1.6M | |
| MBL3200 VL trans.png | 2022-11-07 13:15 | 2.0M | |
| M-700-high-res.jpg | 2023-11-17 12:58 | 113K | |
| Lumin.jpg | 2017-10-23 12:13 | 970K | |
| Lotix_Straight On.png | 2025-01-14 15:06 | 2.8M | |
| Lotix.jpg | 2017-10-23 12:13 | 592K | |
| Logo with slogan.png | 2020-08-18 14:29 | 63K | |
| Lithium Ion Webinar.png | 2021-12-02 08:37 | 550K | |
| LiquidNitrogen_GBAWe..> | 2022-11-07 15:54 | 59K | |
| LiquidNitrogen_GBAWe..> | 2022-11-07 15:52 | 59K | |
| Liquid Nitrogen Gene..> | 2022-11-07 15:58 | 270K | |
| Li-ion Batteries- Sa..> | 2023-05-05 14:25 | 371K | |
| Li-ion Batteries- Sa..> | 2023-05-05 14:24 | 298K | |
| LSSBoat.jpg | 2017-10-23 12:13 | 868K | |
| LM20.jpg | 2024-03-07 10:20 | 64K | |
| KRUSS Gas analyzers.jpg | 2022-11-07 11:08 | 35K | |
| KRUSS Flame Photomet..> | 2022-11-07 10:46 | 192K | |
| KFC13.jpg | 2017-04-18 15:29 | 95K | |
| J2 Scientific.jpg | 2022-05-04 09:46 | 13K | |
| Infographic-ETHOS-X-..> | 2022-08-02 13:02 | 2.0M | |
| Industry-Report_MW-D..> | 2020-12-15 16:52 | 773K | |
| Industry-Report-UW-P..> | 2020-12-15 16:35 | 801K | |
| Industry-Report-UW-P..> | 2020-12-15 16:29 | 801K | |
| Industry-Report-Heav..> | 2020-12-15 16:55 | 1.8M | |
| Industry-Report-ETHO..> | 2025-05-14 08:57 | 946K | |
| Industry-Report-Dige..> | 2020-12-15 16:54 | 829K | |
| Indeed Field Service..> | 2021-12-22 14:02 | 103K | |
| Image_002.jpg | 2022-05-24 10:07 | 42K | |
| Image_001.png | 2022-05-24 10:09 | 3.2K | |
| Image.png | 2017-10-20 09:50 | 19K | |
| IV_Radom_Flyer.pdf | 2023-07-25 15:29 | 550K | |
| How to Connect to VE..> | 2022-10-05 09:52 | 1.0M | |
| High Shear Fluid Pro..> | 2022-12-19 16:17 | 113K | |
| High-Energy Planetar..> | 2022-12-22 14:44 | 36K | |
| Header_1.png | 2023-11-29 14:55 | 1.8M | |
| Header Image Product..> | 2025-02-26 08:47 | 398K | |
| Header.png | 2023-11-29 14:35 | 1.4M | |
| HT3.jpg | 2018-05-24 14:23 | 130K | |
| HG-600 Geno.jpg | 2024-06-24 11:33 | 5.8K | |
| HG-400-09.jpg | 2025-01-24 11:14 | 57K | |
| Guelph - Workshop on..> | 2023-10-02 10:44 | 742K | |
| Guelph - Workshop on..> | 2023-09-26 16:16 | 655K | |
| Guelph - Workshop on..> | 2023-10-02 10:44 | 488K | |
| Guelph - 2nd Worksho..> | 2023-09-28 09:25 | 658K | |
| Geoff looking Ethos ..> | 2025-01-03 14:39 | 200K | |
| GUIDELINES FOR SAMPL..> | 2023-03-24 09:18 | 193K | |
| GENOGRINDER Flyer.png | 2024-06-24 11:28 | 2.0M | |
| GCONV_PATH=./ | 2025-02-16 11:24 | - | |
| Fusion.jpg | 2017-10-23 12:12 | 308K | |
| Full Body Low Angle-..> | 2020-08-18 14:46 | 88K | |
| Food and Feed.jpg | 2025-05-23 11:53 | 1.2M | |
| Flyer_ETHOS_XL_for_T..> | 2022-04-27 10:29 | 2.5M | |
| Flyer_APS-7650G.pdf | 2022-05-03 09:58 | 1.5M | |
| Fiber Analyzers.jpg | 2022-10-04 13:39 | 43K | |
| FOOTER.png | 2025-04-01 16:15 | 141K | |
| FOODS-VELPArticleACo..> | 2025-03-12 15:48 | 3.9M | |
| FOLIO PR - PAC.pdf | 2023-03-31 13:39 | 315K | |
| FIWE ADVANCE 2022.pdf | 2022-10-05 09:50 | 4.5M | |
| FIWE.jpg | 2022-08-31 08:40 | 396K | |
| FIAlab-Environmental..> | 2020-08-18 15:24 | 2.7M | |
| FIAlab-Environmental..> | 2020-08-18 15:13 | 2.6M | |
| FIAlab-Environmental..> | 2020-08-18 15:12 | 2.6M | |
| EthosX_Enviro_AppNot..> | 2025-01-03 15:22 | 4.4M | |
| Ethos X Terpenes - n..> | 2022-07-05 09:49 | 39K | |
| Ethos X Environmenta..> | 2025-01-08 09:06 | 17K | |
| Ethos X Environmenta..> | 2025-01-08 09:05 | 17K | |
| Environmental Analys..> | 2025-04-11 12:06 | 1.7M | |
| Environmental 1_1.jpg | 2025-04-16 13:08 | 1.4M | |
| Environmental 1.jpg | 2025-04-16 13:04 | 1.4M | |
| Emax.png | 2019-01-22 09:24 | 257K | |
| Eltra Logo dl.php.jpg | 2025-01-17 10:49 | 791K | |
| Eltra Elemental anal..> | 2024-06-04 15:38 | 5.2K | |
| Eltra Elemental anal..> | 2022-05-04 11:09 | 67K | |
| EV400.jpg | 2022-11-07 16:01 | 26K | |
| ETHOS XL.png | 2022-09-19 09:27 | 941K | |
| ERWEKA_1.png | 2023-11-29 13:54 | 71K | |
| ERWEKA Product Guide..> | 2024-12-04 13:22 | 89K | |
| ERWEKA Product Guide..> | 2024-12-04 13:18 | 89K | |
| ERWEKA Product Guide..> | 2024-12-04 13:18 | 12K | |
| ERWEKA.png | 2023-11-29 13:47 | 74K | |
| ERWEKA-Offerings_1.png | 2024-03-18 16:47 | 799K | |
| ERWEKA-Offerings.png | 2023-11-29 13:51 | 799K | |
| EMA 502.jpg | 2022-08-30 14:49 | 27K | |
| E-book-Barley and Fe..> | 2022-10-05 09:49 | 841K | |
| Donnazmi.txt/ | 2025-04-29 11:21 | - | |
| Dispersion Technolog..> | 2022-05-04 10:02 | 12K | |
| Dispersion Technolog..> | 2022-05-04 10:04 | 30K | |
| Dispersion Technolog..> | 2022-05-04 10:03 | 7.0K | |
| Dispersion Technolog..> | 2022-05-04 10:01 | 7.0K | |
| Digital_Offline_Syst..> | 2023-12-01 13:27 | 4.9M | |
| Digital_Offline_Syst..> | 2023-12-01 13:22 | 672K | |
| DT_950_Brochure.pdf | 2023-11-29 15:03 | 2.2M | |
| DT 9510 Digital Diss..> | 2023-12-01 12:43 | 3.3M | |
| DT950_Wide_Low.png | 2023-11-29 14:49 | 915K | |
| DT950_1.png | 2023-11-29 14:32 | 1.6M | |
| DT 950 FACTS.png | 2023-11-29 14:15 | 1.4M | |
| DT950.png | 2023-11-29 13:58 | 1.6M | |
| DT950-FRONT.png | 2023-11-29 14:17 | 3.6M | |
| DT950-9510_EN_01_202..> | 2023-12-01 12:49 | 2.9M | |
| DT-126-light-600x400..> | 2023-12-01 09:01 | 20K | |
| DRT - Chewing Gum Te..> | 2023-12-04 11:29 | 1.0M | |
| DMA_80_ROI_Worksheet..> | 2021-01-07 16:12 | 685K | |
| DMA 80 BANNER.png | 2025-05-23 15:18 | 3.2M | |
| DMA80-Technical-Spec..> | 2021-01-07 15:38 | 315K | |
| DKL Series.jpg | 2022-09-01 13:09 | 158K | |
| DFZ II Flow-Through-..> | 2023-12-04 10:37 | 1.1M | |
| DEENA3_product more ..> | 2023-06-30 12:56 | 156K | |
| DEENA3_product more ..> | 2023-06-30 12:52 | 583K | |
| DCG_Logo_Medium.png | 2017-04-18 14:58 | 55K | |
| DCG Partnership Cat..> | 2017-04-18 14:58 | 1.1M | |
| Copy of Copy of Your..> | 2020-04-09 17:11 | 1.6M | |
| Copy of Copy of Your..> | 2020-04-09 17:11 | 1.6M | |
| ChatGPT Image May 23..> | 2025-05-23 11:50 | 1.9M | |
| Catalog-ultraWAVE-3-..> | 2023-05-18 09:39 | 4.7M | |
| Carbolite Nadcap Ove..> | 2017-04-18 14:58 | 743K | |
| Capture 2.jpg | 2020-05-14 12:21 | 55K | |
| Camsizer M1 Applicat..> | 2022-09-30 16:03 | 2.0M | |
| Calgary presentation..> | 2020-02-25 16:07 | 221K | |
| CSI Logo.png | 2024-01-10 12:38 | 18K | |
| CS-580A_2.jpg | 2022-05-09 14:57 | 143K | |
| CS-580A_1.jpg | 2022-05-09 13:05 | 143K | |
| COMING SOON.png | 2023-01-31 10:59 | 22K | |
| COLE PARMER_1.png | 2025-01-27 13:35 | 11K | |
| COLE PARMER.png | 2025-01-21 14:22 | 11K | |
| CN 802_1.jpg | 2022-08-30 15:11 | 220K | |
| CN 802.jpg | 2022-08-30 15:07 | 220K | |
| CG-500-01.jpg | 2025-01-24 11:12 | 72K | |
| CC Solutions for Env..> | 2025-04-01 16:00 | 1.3M | |
| CAMSIZER XL.png | 2023-02-13 11:59 | 29K | |
| CAMSIZER M1.jpg | 2022-09-30 15:58 | 179K | |
| Broschre-DFZII-EN-11..> | 2023-12-04 10:40 | 2.5M | |
| Brochure-easyFILL-US..> | 2023-02-17 19:35 | 4.3M | |
| Breakthrough Analyze..> | 2022-05-04 10:48 | 211K | |
| Blog - Grinders_1.png | 2025-04-23 15:28 | 493K | |
| Blog - Grinders.png | 2025-04-23 15:06 | 503K | |
| Blog - Grinders-2.png | 2025-04-23 15:42 | 579K | |
| Biodis_0467_700.png | 2023-12-04 09:37 | 232K | |
| Bio Safety Cabinets.jpg | 2024-01-12 11:47 | 8.7K | |
| BioDis_RRT_10_EN-01-..> | 2023-12-04 09:43 | 2.0M | |
| BioDis RRT 10.png | 2023-12-04 09:30 | 1.3M | |
| BioDis RRT 10 - view..> | 2023-12-04 09:42 | 810K | |
| BioDis RRT 10 - Tech..> | 2023-12-04 10:13 | 1.5M | |
| BR_Refraktometer_en_..> | 2022-11-07 14:15 | 3.5M | |
| BR_Polarimeter_EN_3...> | 2022-11-07 13:35 | 3.7M | |
| BR_Gasanalysatoren_E..> | 2022-11-08 14:41 | 1.3M | |
| BR_GEMMOLOGICAL STER..> | 2022-11-07 13:20 | 3.4M | |
| BM-450-01.jpg | 2025-01-24 11:11 | 60K | |
| BM-400-12.jpg | 2025-01-24 11:11 | 69K | |
| BM-200_2_Lg.png | 2025-01-24 11:09 | 508K | |
| BLOG - CROSS SELL.png | 2025-04-22 16:14 | 1.1M | |
| BLOG - CROSS SELL.pdf | 2025-04-22 16:14 | 497K | |
| BLOG - CROSS SELL.jpg | 2025-04-23 15:31 | 234K | |
| BELSORP MAX X.jpg | 2023-02-21 10:12 | 98K | |
| BELSORP-HP.jpg | 2023-02-13 13:58 | 23K | |
| BD50 0313.jpg | 2023-06-30 12:49 | 360K | |
| Autoflow.jpg | 2018-01-11 12:28 | 72K | |
| AutoMate-Q40.jpg | 2017-10-23 12:12 | 1.0M | |
| Atri Majaraj Welcome..> | 2025-02-05 11:24 | 1.4M | |
| Atri Majaraj Welcome..> | 2025-02-05 11:20 | 1.3M | |
| Atri Maharaj Welcome..> | 2025-02-05 11:49 | 1.5M | |
| A trans retsch milli..> | 2023-02-21 10:44 | 64K | |
| Atomx XYZ.png | 2022-05-09 15:20 | 241K | |
| Atomx.jpg | 2017-10-23 12:12 | 176K | |
| Ashing-of-polymers-s..> | 2022-02-16 11:11 | 46K | |
| Aralab-FitoClima-600..> | 2022-11-07 15:20 | 2.3M | |
| Aralab-BIO-FitoClima..> | 2022-11-07 15:06 | 583K | |
| AquaTek LVA_sm.jpg | 2022-05-09 16:44 | 40K | |
| Application note - C..> | 2017-04-18 14:58 | 1.1M | |
| AccuPyc II 1345_1.jpg | 2022-06-07 14:40 | 94K | |
| AccuPyc II 1345.jpg | 2022-06-07 14:39 | 94K | |
| Abbe-Refraktometer-A..> | 2022-11-07 14:14 | 454K | |
| ATS_Cannabis Brochur..> | 2022-11-07 16:45 | 2.0M | |
| ATS Scientific Weste..> | 2020-02-20 14:11 | 3.8M | |
| ATS Scientific Weste..> | 2020-02-20 14:10 | 3.8M | |
| ATS Scientific Weste..> | 2020-02-20 14:10 | 3.8M | |
| ATS Scientific - Pre..> | 2021-10-13 11:31 | 130K | |
| ATS Scientific - Pre..> | 2021-10-13 11:29 | 130K | |
| ATS Scientific - Pre..> | 2021-10-13 11:31 | 365K | |
| ATS CSI Promotion_1..> | 2024-01-10 12:58 | 257K | |
| ATS CSI Promotion.jpg | 2024-01-10 12:52 | 257K | |
| ATS-photos-300dpi.zip | 2017-04-18 14:58 | 27M | |
| ATS-RADOM_MINING_BRO..> | 2023-08-02 10:17 | 3.6M | |
| ATS - Live Webcast -..> | 2023-11-28 09:52 | 347K | |
| AR 403.png | 2025-05-07 13:11 | 887K | |
| AQUATek 100.jpg | 2018-05-24 10:23 | 41K | |
| AQ300.jpg | 2023-06-30 12:11 | 150K | |
| APS-7650G_1.jpg | 2022-05-03 10:05 | 56K | |
| APS-7650G.jpg | 2022-05-03 09:40 | 71K | |
| APPLICATION_NOTE-Mic..> | 2024-12-06 15:36 | 1.3M | |
| APPLICATION NOTE-Cel..> | 2025-03-25 09:07 | 2.6M | |
| AIM brochure AXXICON..> | 2024-01-09 11:36 | 5.5M | |
| AIM-slider3.jpg | 2024-01-09 11:32 | 149K | |
| AD st10.png | 2019-01-25 11:21 | 49K | |
| ADSystems_LOGO.jpg | 2019-01-24 16:39 | 235K | |
| ADF and ADL Determin..> | 2022-10-05 09:44 | 654K | |
| AA500_autoanalyzer_1..> | 2023-06-30 12:34 | 331K | |
| AA500_autoanalyzer.jpg | 2023-06-30 12:34 | 331K | |
| AA100 continuous flo..> | 2023-06-30 12:39 | 301K | |
| 3636.jpg | 2017-11-08 09:34 | 32K | |
| 2022-02 - LabTech Xe..> | 2022-11-07 16:21 | 3.8M | |
| 2010_1-large.png | 2018-05-28 13:48 | 269K | |
| 1122_LUBRICATING_OIL..> | 2023-07-25 15:27 | 3.1M | |
| 562d2aaaa72f39a62eda..> | 2022-11-07 10:41 | 401K | |
| 50Yr-Purge-Trap-tn.jpg | 2025-04-30 14:02 | 139K | |
| 15.png | 2020-12-15 16:49 | 743K | |
| 13-ethos-x no backgr..> | 2025-01-16 09:47 | 100K | |
| 2_1.jpg | 2024-01-10 09:52 | 334K | |
| 2.jpg | 2020-05-13 14:44 | 245K | |
| 1_1.jpg | 2024-01-10 09:52 | 353K | |
| 1.jpg | 2020-05-13 14:43 | 409K | |
| 04577_92_LF.jpg | 2025-01-24 13:25 | 298K | |
| 04500_39_RT_open.jpg | 2025-01-24 13:24 | 244K | |
| 04500_05_ST.jpg | 2025-01-24 13:26 | 209K | |
| 0323_MINING_BROCHURE..> | 2023-07-25 15:28 | 3.5M | |
| 0224_MICAP_BROCHURE_..> | 2024-03-20 15:04 | 3.9M | |